About 1,3-bis[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]urea
1,3-bis[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]urea (PubChem CID 135533439) has the molecular formula C15H10Cl4N4O3
and a molecular weight of 436.08 g/mol. Its IUPAC name is 1,3-bis[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]urea.
Molecular Properties
| Compound Name | 1,3-bis[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]urea |
| PubChem CID | 135533439 |
| Molecular Formula | C15H10Cl4N4O3 |
| Molecular Weight | 436.08 g/mol |
| Exact Mass | 433.95 |
| IUPAC Name | 1,3-bis[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]urea |
| SMILES | O=C(N/N=C/c1cc(Cl)cc(Cl)c1O)N/N=C/c1cc(Cl)cc(Cl)c1O |
| InChI | InChI=1S/C15H10Cl4N4O3/c16-9-1-7(13(24)11(18)3-9)5-20-22-15(26)23-21-6-8-2-10(17)4-12(19)14(8)25/h1-6,24-25H,(H2,22,23,26)/b20-5+,21-6+ |
| InChIKey | NQVITINMBMVXCA-FKGLALOMSA-N |
| XLogP | 4.38 |
| TPSA | 106.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 436.08 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1,3-bis[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-bis[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]urea?
The IUPAC name of 1,3-bis[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]urea (CID 135533439) is 1,3-bis[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]urea.
What is the SMILES notation for 1,3-bis[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]urea?
The canonical SMILES for 1,3-bis[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]urea is O=C(N/N=C/c1cc(Cl)cc(Cl)c1O)N/N=C/c1cc(Cl)cc(Cl)c1O.
What is the InChIKey of 1,3-bis[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]urea?
The InChIKey is NQVITINMBMVXCA-FKGLALOMSA-N. The full InChI is InChI=1S/C15H10Cl4N4O3/c16-9-1-7(13(24)11(18)3-9)5-20-22-15(26)23-21-6-8-2-10(17)4-12(19)14(8)25/h1-6,24-25H,(H2,22,23,26)/b20-5+,21-6+.
What are the key properties of 1,3-bis[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]urea?
1,3-bis[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]urea has a molecular weight of 436.08 g/mol, XLogP of 4.38, 4 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-bis[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]urea is sourced from PubChem (CID 135533439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).