C18H14Cl4N4O4S — CID 135436441
N-[(Z)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-2-[2-[(2Z)-2-[(3,5-dichloro-2-hydroxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]sulfanylacetamide (PubChem CID 135436441) has the molecular formula C18H14Cl4N4O4S and a molecular weight of 524.21 g/mol. Its IUPAC name is N-[(Z)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-2-[2-[(2Z)-2-[(3,5-dichloro-2-hydroxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]sulfanylacetamide.
| Compound Name | N-[(Z)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-2-[2-[(2Z)-2-[(3,5-dichloro-2-hydroxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]sulfanylacetamide |
|---|---|
| PubChem CID | 135436441 |
| Molecular Formula | C18H14Cl4N4O4S |
| Molecular Weight | 524.21 g/mol |
| Exact Mass | 521.95 |
| IUPAC Name | N-[(Z)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-2-[2-[(2Z)-2-[(3,5-dichloro-2-hydroxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]sulfanylacetamide |
| SMILES | O=C(CSCC(=O)N/N=C\c1cc(Cl)cc(Cl)c1O)N/N=C\c1cc(Cl)cc(Cl)c1O |
| InChI | InChI=1S/C18H14Cl4N4O4S/c19-11-1-9(17(29)13(21)3-11)5-23-25-15(27)7-31-8-16(28)26-24-6-10-2-12(20)4-14(22)18(10)30/h1-6,29-30H,7-8H2,(H,25,27)(H,26,28)/b23-5-,24-6- |
| InChIKey | PAUJVTJURUVVRG-XIBKSJEISA-N |
| XLogP | 4.05 |
| TPSA | 123.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.21 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|