C8H6Cl2N6O — CID 135537508
2-[(E)-(5-aminotetrazol-1-yl)iminomethyl]-4,6-dichlorophenol (PubChem CID 135537508) has the molecular formula C8H6Cl2N6O and a molecular weight of 273.08 g/mol. Its IUPAC name is 2-[(E)-(5-aminotetrazol-1-yl)iminomethyl]-4,6-dichlorophenol.
| Compound Name | 2-[(E)-(5-aminotetrazol-1-yl)iminomethyl]-4,6-dichlorophenol |
|---|---|
| PubChem CID | 135537508 |
| Molecular Formula | C8H6Cl2N6O |
| Molecular Weight | 273.08 g/mol |
| Exact Mass | 272.00 |
| IUPAC Name | 2-[(E)-(5-aminotetrazol-1-yl)iminomethyl]-4,6-dichlorophenol |
| SMILES | Nc1nnnn1/N=C/c1cc(Cl)cc(Cl)c1O |
| InChI | InChI=1S/C8H6Cl2N6O/c9-5-1-4(7(17)6(10)2-5)3-12-16-8(11)13-14-15-16/h1-3,17H,(H2,11,13,15)/b12-3+ |
| InChIKey | JDWZPNVADVPMTH-KGVSQERTSA-N |
| XLogP | 1.15 |
| TPSA | 102.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.08 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|