C8H8Cl2N4O — CID 135545702
2-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]guanidine (PubChem CID 135545702) has the molecular formula C8H8Cl2N4O and a molecular weight of 247.08 g/mol. Its IUPAC name is 2-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]guanidine.
| Compound Name | 2-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]guanidine |
|---|---|
| PubChem CID | 135545702 |
| Molecular Formula | C8H8Cl2N4O |
| Molecular Weight | 247.08 g/mol |
| Exact Mass | 246.01 |
| IUPAC Name | 2-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]guanidine |
| SMILES | NC(N)=N/N=C/c1cc(Cl)cc(Cl)c1O |
| InChI | InChI=1S/C8H8Cl2N4O/c9-5-1-4(3-13-14-8(11)12)7(15)6(10)2-5/h1-3,15H,(H4,11,12,14)/b13-3+ |
| InChIKey | UKJCBMNZFDBNOW-QLKAYGNNSA-N |
| XLogP | 1.31 |
| TPSA | 96.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.08 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|