About [(E)-1-(3,5-dichloro-2-hydroxyphenyl)ethylideneamino]urea
[(E)-1-(3,5-dichloro-2-hydroxyphenyl)ethylideneamino]urea (PubChem CID 135520619) has the molecular formula C9H9Cl2N3O2
and a molecular weight of 262.10 g/mol. Its IUPAC name is [(E)-1-(3,5-dichloro-2-hydroxyphenyl)ethylideneamino]urea.
Molecular Properties
| Compound Name | [(E)-1-(3,5-dichloro-2-hydroxyphenyl)ethylideneamino]urea |
| PubChem CID | 135520619 |
| Molecular Formula | C9H9Cl2N3O2 |
| Molecular Weight | 262.10 g/mol |
| Exact Mass | 261.01 |
| IUPAC Name | [(E)-1-(3,5-dichloro-2-hydroxyphenyl)ethylideneamino]urea |
| SMILES | C/C(=N\NC(N)=O)c1cc(Cl)cc(Cl)c1O |
| InChI | InChI=1S/C9H9Cl2N3O2/c1-4(13-14-9(12)16)6-2-5(10)3-7(11)8(6)15/h2-3,15H,1H3,(H3,12,14,16)/b13-4+ |
| InChIKey | UFUOEKYHBCFTGW-YIXHJXPBSA-N |
| XLogP | 2.09 |
| TPSA | 87.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.10 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(E)-1-(3,5-dichloro-2-hydroxyphenyl)ethylideneamino]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-1-(3,5-dichloro-2-hydroxyphenyl)ethylideneamino]urea?
The IUPAC name of [(E)-1-(3,5-dichloro-2-hydroxyphenyl)ethylideneamino]urea (CID 135520619) is [(E)-1-(3,5-dichloro-2-hydroxyphenyl)ethylideneamino]urea.
What is the SMILES notation for [(E)-1-(3,5-dichloro-2-hydroxyphenyl)ethylideneamino]urea?
The canonical SMILES for [(E)-1-(3,5-dichloro-2-hydroxyphenyl)ethylideneamino]urea is C/C(=N\NC(N)=O)c1cc(Cl)cc(Cl)c1O.
What is the InChIKey of [(E)-1-(3,5-dichloro-2-hydroxyphenyl)ethylideneamino]urea?
The InChIKey is UFUOEKYHBCFTGW-YIXHJXPBSA-N. The full InChI is InChI=1S/C9H9Cl2N3O2/c1-4(13-14-9(12)16)6-2-5(10)3-7(11)8(6)15/h2-3,15H,1H3,(H3,12,14,16)/b13-4+.
What are the key properties of [(E)-1-(3,5-dichloro-2-hydroxyphenyl)ethylideneamino]urea?
[(E)-1-(3,5-dichloro-2-hydroxyphenyl)ethylideneamino]urea has a molecular weight of 262.10 g/mol, XLogP of 2.09, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-1-(3,5-dichloro-2-hydroxyphenyl)ethylideneamino]urea is sourced from PubChem (CID 135520619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).