C9H9Cl2N3O2 — CID 135520619
[(E)-1-(3,5-dichloro-2-hydroxyphenyl)ethylideneamino]urea (PubChem CID 135520619) has the molecular formula C9H9Cl2N3O2 and a molecular weight of 262.10 g/mol. Its IUPAC name is [(E)-1-(3,5-dichloro-2-hydroxyphenyl)ethylideneamino]urea.
| Compound Name | [(E)-1-(3,5-dichloro-2-hydroxyphenyl)ethylideneamino]urea |
|---|---|
| PubChem CID | 135520619 |
| Molecular Formula | C9H9Cl2N3O2 |
| Molecular Weight | 262.10 g/mol |
| Exact Mass | 261.01 |
| IUPAC Name | [(E)-1-(3,5-dichloro-2-hydroxyphenyl)ethylideneamino]urea |
| SMILES | C/C(=N\NC(N)=O)c1cc(Cl)cc(Cl)c1O |
| InChI | InChI=1S/C9H9Cl2N3O2/c1-4(13-14-9(12)16)6-2-5(10)3-7(11)8(6)15/h2-3,15H,1H3,(H3,12,14,16)/b13-4+ |
| InChIKey | UFUOEKYHBCFTGW-YIXHJXPBSA-N |
| XLogP | 2.09 |
| TPSA | 87.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.10 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|