C23H21ClN2O5 — CID 135854665
2-[(Z)-1-chloro-2-(3-ethoxy-4-prop-2-ynoxyphenyl)ethenyl]-6,7-dimethoxy-3H-quinazolin-4-one (PubChem CID 135854665) has the molecular formula C23H21ClN2O5 and a molecular weight of 440.88 g/mol. Its IUPAC name is 2-[(Z)-1-chloro-2-(3-ethoxy-4-prop-2-ynoxyphenyl)ethenyl]-6,7-dimethoxy-3H-quinazolin-4-one.
| Compound Name | 2-[(Z)-1-chloro-2-(3-ethoxy-4-prop-2-ynoxyphenyl)ethenyl]-6,7-dimethoxy-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 135854665 |
| Molecular Formula | C23H21ClN2O5 |
| Molecular Weight | 440.88 g/mol |
| Exact Mass | 440.11 |
| IUPAC Name | 2-[(Z)-1-chloro-2-(3-ethoxy-4-prop-2-ynoxyphenyl)ethenyl]-6,7-dimethoxy-3H-quinazolin-4-one |
| SMILES | C#CCOc1ccc(/C=C(\Cl)c2nc3cc(OC)c(OC)cc3c(=O)[nH]2)cc1OCC |
| InChI | InChI=1S/C23H21ClN2O5/c1-5-9-31-18-8-7-14(11-21(18)30-6-2)10-16(24)22-25-17-13-20(29-4)19(28-3)12-15(17)23(27)26-22/h1,7-8,10-13H,6,9H2,2-4H3,(H,25,26,27)/b16-10- |
| InChIKey | XDOIOCXNJKOZTI-YBEGLDIGSA-N |
| XLogP | 4.09 |
| TPSA | 82.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.88 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|