C20H19ClN2O3 — CID 135725671
2-[(Z)-1-chloro-2-(4-ethoxy-3-methoxyphenyl)ethenyl]-8-methyl-3H-quinazolin-4-one (PubChem CID 135725671) has the molecular formula C20H19ClN2O3 and a molecular weight of 370.84 g/mol. Its IUPAC name is 2-[(Z)-1-chloro-2-(4-ethoxy-3-methoxyphenyl)ethenyl]-8-methyl-3H-quinazolin-4-one.
| Compound Name | 2-[(Z)-1-chloro-2-(4-ethoxy-3-methoxyphenyl)ethenyl]-8-methyl-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 135725671 |
| Molecular Formula | C20H19ClN2O3 |
| Molecular Weight | 370.84 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | 2-[(Z)-1-chloro-2-(4-ethoxy-3-methoxyphenyl)ethenyl]-8-methyl-3H-quinazolin-4-one |
| SMILES | CCOc1ccc(/C=C(\Cl)c2nc3c(C)cccc3c(=O)[nH]2)cc1OC |
| InChI | InChI=1S/C20H19ClN2O3/c1-4-26-16-9-8-13(11-17(16)25-3)10-15(21)19-22-18-12(2)6-5-7-14(18)20(24)23-19/h5-11H,4H2,1-3H3,(H,22,23,24)/b15-10- |
| InChIKey | LNCALGQGKBZHLV-GDNBJRDFSA-N |
| XLogP | 4.38 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.84 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |