C22H19ClN2O3 — CID 135725686
2-[(Z)-1-chloro-2-(3-ethoxy-4-prop-2-ynoxyphenyl)ethenyl]-8-methyl-3H-quinazolin-4-one (PubChem CID 135725686) has the molecular formula C22H19ClN2O3 and a molecular weight of 394.86 g/mol. Its IUPAC name is 2-[(Z)-1-chloro-2-(3-ethoxy-4-prop-2-ynoxyphenyl)ethenyl]-8-methyl-3H-quinazolin-4-one.
| Compound Name | 2-[(Z)-1-chloro-2-(3-ethoxy-4-prop-2-ynoxyphenyl)ethenyl]-8-methyl-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 135725686 |
| Molecular Formula | C22H19ClN2O3 |
| Molecular Weight | 394.86 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | 2-[(Z)-1-chloro-2-(3-ethoxy-4-prop-2-ynoxyphenyl)ethenyl]-8-methyl-3H-quinazolin-4-one |
| SMILES | C#CCOc1ccc(/C=C(\Cl)c2nc3c(C)cccc3c(=O)[nH]2)cc1OCC |
| InChI | InChI=1S/C22H19ClN2O3/c1-4-11-28-18-10-9-15(13-19(18)27-5-2)12-17(23)21-24-20-14(3)7-6-8-16(20)22(26)25-21/h1,6-10,12-13H,5,11H2,2-3H3,(H,24,25,26)/b17-12- |
| InChIKey | NWAHZPRENNNJIV-ATVHPVEESA-N |
| XLogP | 4.38 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.86 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|