C12H17N4+ — CID 135855705
N-[(E)-1-phenylethylideneamino]-1,4,5,6-tetrahydropyrimidin-3-ium-2-amine (PubChem CID 135855705) has the molecular formula C12H17N4+ and a molecular weight of 217.30 g/mol. Its IUPAC name is N-[(E)-1-phenylethylideneamino]-1,4,5,6-tetrahydropyrimidin-3-ium-2-amine.
| Compound Name | N-[(E)-1-phenylethylideneamino]-1,4,5,6-tetrahydropyrimidin-3-ium-2-amine |
|---|---|
| PubChem CID | 135855705 |
| Molecular Formula | C12H17N4+ |
| Molecular Weight | 217.30 g/mol |
| Exact Mass | 217.14 |
| IUPAC Name | N-[(E)-1-phenylethylideneamino]-1,4,5,6-tetrahydropyrimidin-3-ium-2-amine |
| SMILES | C/C(=N\NC1=[NH+]CCCN1)c1ccccc1 |
| InChI | InChI=1S/C12H16N4/c1-10(11-6-3-2-4-7-11)15-16-12-13-8-5-9-14-12/h2-4,6-7H,5,8-9H2,1H3,(H2,13,14,16)/p+1/b15-10+ |
| InChIKey | AQSDMHQYTIWKPI-XNTDXEJSSA-O |
| XLogP | -0.57 |
| TPSA | 50.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.30 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|