C16H25N4O+ — CID 135858999
N-[(Z)-1-(4-pentoxyphenyl)ethylideneamino]-4,5-dihydro-1H-imidazol-3-ium-2-amine (PubChem CID 135858999) has the molecular formula C16H25N4O+ and a molecular weight of 289.40 g/mol. Its IUPAC name is N-[(Z)-1-(4-pentoxyphenyl)ethylideneamino]-4,5-dihydro-1H-imidazol-3-ium-2-amine.
| Compound Name | N-[(Z)-1-(4-pentoxyphenyl)ethylideneamino]-4,5-dihydro-1H-imidazol-3-ium-2-amine |
|---|---|
| PubChem CID | 135858999 |
| Molecular Formula | C16H25N4O+ |
| Molecular Weight | 289.40 g/mol |
| Exact Mass | 289.20 |
| IUPAC Name | N-[(Z)-1-(4-pentoxyphenyl)ethylideneamino]-4,5-dihydro-1H-imidazol-3-ium-2-amine |
| SMILES | CCCCCOc1ccc(/C(C)=N\NC2=[NH+]CCN2)cc1 |
| InChI | InChI=1S/C16H24N4O/c1-3-4-5-12-21-15-8-6-14(7-9-15)13(2)19-20-16-17-10-11-18-16/h6-9H,3-5,10-12H2,1-2H3,(H2,17,18,20)/p+1/b19-13- |
| InChIKey | XHNKZHYYGVYZHJ-UYRXBGFRSA-O |
| XLogP | 0.61 |
| TPSA | 59.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.40 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|