C15H22N5O3+ — CID 135909948
N-[(Z)-1-(4-butoxy-3-nitrophenyl)ethylideneamino]-4,5-dihydro-1H-imidazol-3-ium-2-amine (PubChem CID 135909948) has the molecular formula C15H22N5O3+ and a molecular weight of 320.37 g/mol. Its IUPAC name is N-[(Z)-1-(4-butoxy-3-nitrophenyl)ethylideneamino]-4,5-dihydro-1H-imidazol-3-ium-2-amine.
| Compound Name | N-[(Z)-1-(4-butoxy-3-nitrophenyl)ethylideneamino]-4,5-dihydro-1H-imidazol-3-ium-2-amine |
|---|---|
| PubChem CID | 135909948 |
| Molecular Formula | C15H22N5O3+ |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | N-[(Z)-1-(4-butoxy-3-nitrophenyl)ethylideneamino]-4,5-dihydro-1H-imidazol-3-ium-2-amine |
| SMILES | CCCCOc1ccc(/C(C)=N\NC2=[NH+]CCN2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H21N5O3/c1-3-4-9-23-14-6-5-12(10-13(14)20(21)22)11(2)18-19-15-16-7-8-17-15/h5-6,10H,3-4,7-9H2,1-2H3,(H2,16,17,19)/p+1/b18-11- |
| InChIKey | GDOHTDAIGMHVTQ-WQRHYEAKSA-O |
| XLogP | 0.13 |
| TPSA | 102.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|