C16H13NO3 — CID 135855834
4-[3-(4-hydroxyphenyl)-4-methyl-1,2-oxazol-5-yl]phenol (PubChem CID 135855834) has the molecular formula C16H13NO3 and a molecular weight of 267.28 g/mol. Its IUPAC name is 4-[3-(4-hydroxyphenyl)-4-methyl-1,2-oxazol-5-yl]phenol.
| Compound Name | 4-[3-(4-hydroxyphenyl)-4-methyl-1,2-oxazol-5-yl]phenol |
|---|---|
| PubChem CID | 135855834 |
| Molecular Formula | C16H13NO3 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | 4-[3-(4-hydroxyphenyl)-4-methyl-1,2-oxazol-5-yl]phenol |
| SMILES | Cc1c(-c2ccc(O)cc2)noc1-c1ccc(O)cc1 |
| InChI | InChI=1S/C16H13NO3/c1-10-15(11-2-6-13(18)7-3-11)17-20-16(10)12-4-8-14(19)9-5-12/h2-9,18-19H,1H3 |
| InChIKey | KYEHLKLLPVOFQA-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |