C22H14FNO4 — CID 135855811
[3,5-bis(4-hydroxyphenyl)-1,2-oxazol-4-yl]-(2-fluorophenyl)methanone (PubChem CID 135855811) has the molecular formula C22H14FNO4 and a molecular weight of 375.36 g/mol. Its IUPAC name is [3,5-bis(4-hydroxyphenyl)-1,2-oxazol-4-yl]-(2-fluorophenyl)methanone.
| Compound Name | [3,5-bis(4-hydroxyphenyl)-1,2-oxazol-4-yl]-(2-fluorophenyl)methanone |
|---|---|
| PubChem CID | 135855811 |
| Molecular Formula | C22H14FNO4 |
| Molecular Weight | 375.36 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | [3,5-bis(4-hydroxyphenyl)-1,2-oxazol-4-yl]-(2-fluorophenyl)methanone |
| SMILES | O=C(c1ccccc1F)c1c(-c2ccc(O)cc2)noc1-c1ccc(O)cc1 |
| InChI | InChI=1S/C22H14FNO4/c23-18-4-2-1-3-17(18)21(27)19-20(13-5-9-15(25)10-6-13)24-28-22(19)14-7-11-16(26)12-8-14/h1-12,25-26H |
| InChIKey | BXOJOURAWYYHMM-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.36 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |