About (2-fluorophenyl)-(5-methyl-1,2-oxazol-4-yl)methanone
(2-fluorophenyl)-(5-methyl-1,2-oxazol-4-yl)methanone (PubChem CID 82282946) has the molecular formula C11H8FNO2
and a molecular weight of 205.19 g/mol. Its IUPAC name is (2-fluorophenyl)-(5-methyl-1,2-oxazol-4-yl)methanone.
Analyze (2-fluorophenyl)-(5-methyl-1,2-oxazol-4-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-fluorophenyl)-(5-methyl-1,2-oxazol-4-yl)methanone?
The IUPAC name of (2-fluorophenyl)-(5-methyl-1,2-oxazol-4-yl)methanone (CID 82282946) is (2-fluorophenyl)-(5-methyl-1,2-oxazol-4-yl)methanone.
What is the SMILES notation for (2-fluorophenyl)-(5-methyl-1,2-oxazol-4-yl)methanone?
The canonical SMILES for (2-fluorophenyl)-(5-methyl-1,2-oxazol-4-yl)methanone is Cc1oncc1C(=O)c1ccccc1F.
What is the InChIKey of (2-fluorophenyl)-(5-methyl-1,2-oxazol-4-yl)methanone?
The InChIKey is MMFFRSUXNMMGQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8FNO2/c1-7-9(6-13-15-7)11(14)8-4-2-3-5-10(8)12/h2-6H,1H3.
What are the key properties of (2-fluorophenyl)-(5-methyl-1,2-oxazol-4-yl)methanone?
(2-fluorophenyl)-(5-methyl-1,2-oxazol-4-yl)methanone has a molecular weight of 205.19 g/mol, XLogP of 2.35, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-fluorophenyl)-(5-methyl-1,2-oxazol-4-yl)methanone is sourced from PubChem (CID 82282946), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).