C15H18BrN4O3- — CID 135856029
N,N-dimethylcarbamate;1-methyl-6-phenyldiazenylpyridin-1-ium-3-ol;bromide (PubChem CID 135856029) has the molecular formula C15H18BrN4O3- and a molecular weight of 382.24 g/mol. Its IUPAC name is N,N-dimethylcarbamate;1-methyl-6-phenyldiazenylpyridin-1-ium-3-ol;bromide.
| Compound Name | N,N-dimethylcarbamate;1-methyl-6-phenyldiazenylpyridin-1-ium-3-ol;bromide |
|---|---|
| PubChem CID | 135856029 |
| Molecular Formula | C15H18BrN4O3- |
| Molecular Weight | 382.24 g/mol |
| Exact Mass | 381.06 |
| IUPAC Name | N,N-dimethylcarbamate;1-methyl-6-phenyldiazenylpyridin-1-ium-3-ol;bromide |
| SMILES | CN(C)C(=O)[O-].C[n+]1cc(O)ccc1/N=N/c1ccccc1.[Br-] |
| InChI | InChI=1S/C12H11N3O.C3H7NO2.BrH/c1-15-9-11(16)7-8-12(15)14-13-10-5-3-2-4-6-10;1-4(2)3(5)6;/h2-9H,1H3;1-2H3,(H,5,6);1H/p-1 |
| InChIKey | SAMPPFDTORWLNJ-UHFFFAOYSA-M |
| XLogP | -1.47 |
| TPSA | 92.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.24 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|