C26H30ClN5O4 — CID 135859142
3-[3-[4-[(2-chlorophenyl)methoxy]phenyl]-5-oxo-4H-1,2,4-triazin-6-yl]-N-(3-morpholin-4-ylpropyl)propanamide (PubChem CID 135859142) has the molecular formula C26H30ClN5O4 and a molecular weight of 512.01 g/mol. Its IUPAC name is 3-[3-[4-[(2-chlorophenyl)methoxy]phenyl]-5-oxo-4H-1,2,4-triazin-6-yl]-N-(3-morpholin-4-ylpropyl)propanamide.
| Compound Name | 3-[3-[4-[(2-chlorophenyl)methoxy]phenyl]-5-oxo-4H-1,2,4-triazin-6-yl]-N-(3-morpholin-4-ylpropyl)propanamide |
|---|---|
| PubChem CID | 135859142 |
| Molecular Formula | C26H30ClN5O4 |
| Molecular Weight | 512.01 g/mol |
| Exact Mass | 511.20 |
| IUPAC Name | 3-[3-[4-[(2-chlorophenyl)methoxy]phenyl]-5-oxo-4H-1,2,4-triazin-6-yl]-N-(3-morpholin-4-ylpropyl)propanamide |
| SMILES | O=C(CCc1nnc(-c2ccc(OCc3ccccc3Cl)cc2)[nH]c1=O)NCCCN1CCOCC1 |
| InChI | InChI=1S/C26H30ClN5O4/c27-22-5-2-1-4-20(22)18-36-21-8-6-19(7-9-21)25-29-26(34)23(30-31-25)10-11-24(33)28-12-3-13-32-14-16-35-17-15-32/h1-2,4-9H,3,10-18H2,(H,28,33)(H,29,31,34) |
| InChIKey | KIYBRWJCCKRAJG-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 109.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.01 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|