C23H29N7O2 — CID 135867306
3-(1-cyclohexyl-4-oxo-5H-pyrazolo[5,4-d]pyrimidin-6-yl)-N-[4-(dimethylamino)phenyl]azetidine-1-carboxamide (PubChem CID 135867306) has the molecular formula C23H29N7O2 and a molecular weight of 435.53 g/mol. Its IUPAC name is 3-(1-cyclohexyl-4-oxo-5H-pyrazolo[5,4-d]pyrimidin-6-yl)-N-[4-(dimethylamino)phenyl]azetidine-1-carboxamide.
| Compound Name | 3-(1-cyclohexyl-4-oxo-5H-pyrazolo[5,4-d]pyrimidin-6-yl)-N-[4-(dimethylamino)phenyl]azetidine-1-carboxamide |
|---|---|
| PubChem CID | 135867306 |
| Molecular Formula | C23H29N7O2 |
| Molecular Weight | 435.53 g/mol |
| Exact Mass | 435.24 |
| IUPAC Name | 3-(1-cyclohexyl-4-oxo-5H-pyrazolo[5,4-d]pyrimidin-6-yl)-N-[4-(dimethylamino)phenyl]azetidine-1-carboxamide |
| SMILES | CN(C)c1ccc(NC(=O)N2CC(c3nc4c(cnn4C4CCCCC4)c(=O)[nH]3)C2)cc1 |
| InChI | InChI=1S/C23H29N7O2/c1-28(2)17-10-8-16(9-11-17)25-23(32)29-13-15(14-29)20-26-21-19(22(31)27-20)12-24-30(21)18-6-4-3-5-7-18/h8-12,15,18H,3-7,13-14H2,1-2H3,(H,25,32)(H,26,27,31) |
| InChIKey | WLMBPDBCSGIOEU-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 99.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.53 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|