C15H18N4OS — CID 135867412
4-(4-methoxyphenyl)-3-propan-2-yl-2,4,5,7-tetrahydropyrazolo[3,4-d]pyrimidine-6-thione (PubChem CID 135867412) has the molecular formula C15H18N4OS and a molecular weight of 302.40 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-3-propan-2-yl-2,4,5,7-tetrahydropyrazolo[3,4-d]pyrimidine-6-thione.
| Compound Name | 4-(4-methoxyphenyl)-3-propan-2-yl-2,4,5,7-tetrahydropyrazolo[3,4-d]pyrimidine-6-thione |
|---|---|
| PubChem CID | 135867412 |
| Molecular Formula | C15H18N4OS |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | 4-(4-methoxyphenyl)-3-propan-2-yl-2,4,5,7-tetrahydropyrazolo[3,4-d]pyrimidine-6-thione |
| SMILES | COc1ccc(C2NC(=S)Nc3n[nH]c(C(C)C)c32)cc1 |
| InChI | InChI=1S/C15H18N4OS/c1-8(2)12-11-13(9-4-6-10(20-3)7-5-9)16-15(21)17-14(11)19-18-12/h4-8,13H,1-3H3,(H3,16,17,18,19,21) |
| InChIKey | ZBGBQSZMSYITFH-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 61.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|