C21H19ClN5OPS2 — CID 139215962
8-(4-chlorophenyl)-12-(4-methoxyphenyl)-6-methyl-12-sulfanylidene-2,4,5,11,13-pentaza-12λ5-phosphatricyclo[7.4.0.03,7]trideca-1(9),3,6-triene-10-thione (PubChem CID 139215962) has the molecular formula C21H19ClN5OPS2 and a molecular weight of 487.98 g/mol. Its IUPAC name is 8-(4-chlorophenyl)-12-(4-methoxyphenyl)-6-methyl-12-sulfanylidene-2,4,5,11,13-pentaza-12λ5-phosphatricyclo[7.4.0.03,7]trideca-1(9),3,6-triene-10-thione.
| Compound Name | 8-(4-chlorophenyl)-12-(4-methoxyphenyl)-6-methyl-12-sulfanylidene-2,4,5,11,13-pentaza-12λ5-phosphatricyclo[7.4.0.03,7]trideca-1(9),3,6-triene-10-thione |
|---|---|
| PubChem CID | 139215962 |
| Molecular Formula | C21H19ClN5OPS2 |
| Molecular Weight | 487.98 g/mol |
| Exact Mass | 487.05 |
| IUPAC Name | 8-(4-chlorophenyl)-12-(4-methoxyphenyl)-6-methyl-12-sulfanylidene-2,4,5,11,13-pentaza-12λ5-phosphatricyclo[7.4.0.03,7]trideca-1(9),3,6-triene-10-thione |
| SMILES | COc1ccc(P2(=S)NC(=S)C3=C(Nc4n[nH]c(C)c4C3c3ccc(Cl)cc3)N2)cc1 |
| InChI | InChI=1S/C21H19ClN5OPS2/c1-11-16-17(12-3-5-13(22)6-4-12)18-20(23-19(16)25-24-11)26-29(31,27-21(18)30)15-9-7-14(28-2)8-10-15/h3-10,17H,1-2H3,(H4,23,24,25,26,27,30,31) |
| InChIKey | BAPXYLCVERMQOT-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 74.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.98 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|