C22H22N4O4 — CID 135868855
3-[3-(1,3-benzodioxol-5-yl)-5-oxo-4H-1,2,4-triazin-6-yl]-N-(3-phenylpropyl)propanamide (PubChem CID 135868855) has the molecular formula C22H22N4O4 and a molecular weight of 406.44 g/mol. Its IUPAC name is 3-[3-(1,3-benzodioxol-5-yl)-5-oxo-4H-1,2,4-triazin-6-yl]-N-(3-phenylpropyl)propanamide.
| Compound Name | 3-[3-(1,3-benzodioxol-5-yl)-5-oxo-4H-1,2,4-triazin-6-yl]-N-(3-phenylpropyl)propanamide |
|---|---|
| PubChem CID | 135868855 |
| Molecular Formula | C22H22N4O4 |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | 3-[3-(1,3-benzodioxol-5-yl)-5-oxo-4H-1,2,4-triazin-6-yl]-N-(3-phenylpropyl)propanamide |
| SMILES | O=C(CCc1nnc(-c2ccc3c(c2)OCO3)[nH]c1=O)NCCCc1ccccc1 |
| InChI | InChI=1S/C22H22N4O4/c27-20(23-12-4-7-15-5-2-1-3-6-15)11-9-17-22(28)24-21(26-25-17)16-8-10-18-19(13-16)30-14-29-18/h1-3,5-6,8,10,13H,4,7,9,11-12,14H2,(H,23,27)(H,24,26,28) |
| InChIKey | CHVVVWNHRBMKPA-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|