C19H26N4O3S — CID 135869799
5-[[(2S)-2-(dimethylamino)-2-(4-methoxyphenyl)ethyl]iminomethyl]-6-hydroxy-1-propyl-2-sulfanylidenepyrimidin-4-one (PubChem CID 135869799) has the molecular formula C19H26N4O3S and a molecular weight of 390.51 g/mol. Its IUPAC name is 5-[[(2S)-2-(dimethylamino)-2-(4-methoxyphenyl)ethyl]iminomethyl]-6-hydroxy-1-propyl-2-sulfanylidenepyrimidin-4-one.
| Compound Name | 5-[[(2S)-2-(dimethylamino)-2-(4-methoxyphenyl)ethyl]iminomethyl]-6-hydroxy-1-propyl-2-sulfanylidenepyrimidin-4-one |
|---|---|
| PubChem CID | 135869799 |
| Molecular Formula | C19H26N4O3S |
| Molecular Weight | 390.51 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | 5-[[(2S)-2-(dimethylamino)-2-(4-methoxyphenyl)ethyl]iminomethyl]-6-hydroxy-1-propyl-2-sulfanylidenepyrimidin-4-one |
| SMILES | CCCn1c(O)c(/C=N/C[C@H](c2ccc(OC)cc2)N(C)C)c(=O)[nH]c1=S |
| InChI | InChI=1S/C19H26N4O3S/c1-5-10-23-18(25)15(17(24)21-19(23)27)11-20-12-16(22(2)3)13-6-8-14(26-4)9-7-13/h6-9,11,16,25H,5,10,12H2,1-4H3,(H,21,24,27)/b20-11+/t16-/m1/s1 |
| InChIKey | PVHFJVWTYPYCES-MBTVCVBTSA-N |
| XLogP | 2.75 |
| TPSA | 82.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.51 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|