C15H21N5O2 — CID 135871050
5-(3,4-dihydro-2H-pyran-2-yl)-1-(3-imidazol-1-ylpropyl)-4-methyliminoimidazolidin-2-one (PubChem CID 135871050) has the molecular formula C15H21N5O2 and a molecular weight of 303.37 g/mol. Its IUPAC name is 5-(3,4-dihydro-2H-pyran-2-yl)-1-(3-imidazol-1-ylpropyl)-4-methyliminoimidazolidin-2-one.
| Compound Name | 5-(3,4-dihydro-2H-pyran-2-yl)-1-(3-imidazol-1-ylpropyl)-4-methyliminoimidazolidin-2-one |
|---|---|
| PubChem CID | 135871050 |
| Molecular Formula | C15H21N5O2 |
| Molecular Weight | 303.37 g/mol |
| Exact Mass | 303.17 |
| IUPAC Name | 5-(3,4-dihydro-2H-pyran-2-yl)-1-(3-imidazol-1-ylpropyl)-4-methyliminoimidazolidin-2-one |
| SMILES | C/N=C1\NC(=O)N(CCCn2ccnc2)C1C1CCC=CO1 |
| InChI | InChI=1S/C15H21N5O2/c1-16-14-13(12-5-2-3-10-22-12)20(15(21)18-14)8-4-7-19-9-6-17-11-19/h3,6,9-13H,2,4-5,7-8H2,1H3,(H,16,18,21) |
| InChIKey | MRVPENGMAPNWBG-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 71.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.37 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|