C21H24ClN5OS — CID 136600135
5-(6-chlorocyclohexa-2,4-dien-1-yl)-1-(3-imidazol-1-ylpropyl)-4-(2-thiophen-2-ylethylimino)imidazolidin-2-one (PubChem CID 136600135) has the molecular formula C21H24ClN5OS and a molecular weight of 429.98 g/mol. Its IUPAC name is 5-(6-chlorocyclohexa-2,4-dien-1-yl)-1-(3-imidazol-1-ylpropyl)-4-(2-thiophen-2-ylethylimino)imidazolidin-2-one.
| Compound Name | 5-(6-chlorocyclohexa-2,4-dien-1-yl)-1-(3-imidazol-1-ylpropyl)-4-(2-thiophen-2-ylethylimino)imidazolidin-2-one |
|---|---|
| PubChem CID | 136600135 |
| Molecular Formula | C21H24ClN5OS |
| Molecular Weight | 429.98 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | 5-(6-chlorocyclohexa-2,4-dien-1-yl)-1-(3-imidazol-1-ylpropyl)-4-(2-thiophen-2-ylethylimino)imidazolidin-2-one |
| SMILES | O=C1N/C(=N\CCc2cccs2)C(C2C=CC=CC2Cl)N1CCCn1ccnc1 |
| InChI | InChI=1S/C21H24ClN5OS/c22-18-7-2-1-6-17(18)19-20(24-9-8-16-5-3-14-29-16)25-21(28)27(19)12-4-11-26-13-10-23-15-26/h1-3,5-7,10,13-15,17-19H,4,8-9,11-12H2,(H,24,25,28) |
| InChIKey | LPNKQYNISFRJNI-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 62.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.98 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|