C21H21ClFN5OS — CID 135871082
5-(4-chloro-3-fluorophenyl)-1-(3-imidazol-1-ylpropyl)-4-(2-thiophen-2-ylethylimino)imidazolidin-2-one (PubChem CID 135871082) has the molecular formula C21H21ClFN5OS and a molecular weight of 445.95 g/mol. Its IUPAC name is 5-(4-chloro-3-fluorophenyl)-1-(3-imidazol-1-ylpropyl)-4-(2-thiophen-2-ylethylimino)imidazolidin-2-one.
| Compound Name | 5-(4-chloro-3-fluorophenyl)-1-(3-imidazol-1-ylpropyl)-4-(2-thiophen-2-ylethylimino)imidazolidin-2-one |
|---|---|
| PubChem CID | 135871082 |
| Molecular Formula | C21H21ClFN5OS |
| Molecular Weight | 445.95 g/mol |
| Exact Mass | 445.11 |
| IUPAC Name | 5-(4-chloro-3-fluorophenyl)-1-(3-imidazol-1-ylpropyl)-4-(2-thiophen-2-ylethylimino)imidazolidin-2-one |
| SMILES | O=C1N/C(=N\CCc2cccs2)C(c2ccc(Cl)c(F)c2)N1CCCn1ccnc1 |
| InChI | InChI=1S/C21H21ClFN5OS/c22-17-5-4-15(13-18(17)23)19-20(25-7-6-16-3-1-12-30-16)26-21(29)28(19)10-2-9-27-11-8-24-14-27/h1,3-5,8,11-14,19H,2,6-7,9-10H2,(H,25,26,29) |
| InChIKey | ANYGTCRJVONWRU-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 62.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.95 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|