C11H13ClN2OS — CID 67780593
4-imidazol-1-yl-1-thiophen-2-ylbutan-2-one;hydrochloride (PubChem CID 67780593) has the molecular formula C11H13ClN2OS and a molecular weight of 256.76 g/mol. Its IUPAC name is 4-imidazol-1-yl-1-thiophen-2-ylbutan-2-one;hydrochloride.
| Compound Name | 4-imidazol-1-yl-1-thiophen-2-ylbutan-2-one;hydrochloride |
|---|---|
| PubChem CID | 67780593 |
| Molecular Formula | C11H13ClN2OS |
| Molecular Weight | 256.76 g/mol |
| Exact Mass | 256.04 |
| IUPAC Name | 4-imidazol-1-yl-1-thiophen-2-ylbutan-2-one;hydrochloride |
| SMILES | Cl.O=C(CCn1ccnc1)Cc1cccs1 |
| InChI | InChI=1S/C11H12N2OS.ClH/c14-10(8-11-2-1-7-15-11)3-5-13-6-4-12-9-13;/h1-2,4,6-7,9H,3,5,8H2;1H |
| InChIKey | HLMFXPMVSOKLNF-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.76 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |