C7H9F3N4O3 — CID 135871408
(NE)-N-[1-[(E)-4,4,4-trifluoro-3-hydroxybut-2-enyl]imidazolidin-2-ylidene]nitramide (PubChem CID 135871408) has the molecular formula C7H9F3N4O3 and a molecular weight of 254.17 g/mol. Its IUPAC name is (NE)-N-[1-[(E)-4,4,4-trifluoro-3-hydroxybut-2-enyl]imidazolidin-2-ylidene]nitramide.
| Compound Name | (NE)-N-[1-[(E)-4,4,4-trifluoro-3-hydroxybut-2-enyl]imidazolidin-2-ylidene]nitramide |
|---|---|
| PubChem CID | 135871408 |
| Molecular Formula | C7H9F3N4O3 |
| Molecular Weight | 254.17 g/mol |
| Exact Mass | 254.06 |
| IUPAC Name | (NE)-N-[1-[(E)-4,4,4-trifluoro-3-hydroxybut-2-enyl]imidazolidin-2-ylidene]nitramide |
| SMILES | O=[N+]([O-])/N=C1\NCCN1C/C=C(/O)C(F)(F)F |
| InChI | InChI=1S/C7H9F3N4O3/c8-7(9,10)5(15)1-3-13-4-2-11-6(13)12-14(16)17/h1,15H,2-4H2,(H,11,12)/b5-1+ |
| InChIKey | TVKSRXAFDWNJIR-ORCRQEGFSA-N |
| XLogP | 0.44 |
| TPSA | 91.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.17 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|