C6H11N5O3 — CID 135804934
(2Z)-N,N-dimethyl-2-nitroiminoimidazolidine-1-carboxamide (PubChem CID 135804934) has the molecular formula C6H11N5O3 and a molecular weight of 201.19 g/mol. Its IUPAC name is (2Z)-N,N-dimethyl-2-nitroiminoimidazolidine-1-carboxamide.
| Compound Name | (2Z)-N,N-dimethyl-2-nitroiminoimidazolidine-1-carboxamide |
|---|---|
| PubChem CID | 135804934 |
| Molecular Formula | C6H11N5O3 |
| Molecular Weight | 201.19 g/mol |
| Exact Mass | 201.09 |
| IUPAC Name | (2Z)-N,N-dimethyl-2-nitroiminoimidazolidine-1-carboxamide |
| SMILES | CN(C)C(=O)N1CCN/C1=N/[N+](=O)[O-] |
| InChI | InChI=1S/C6H11N5O3/c1-9(2)6(12)10-4-3-7-5(10)8-11(13)14/h3-4H2,1-2H3,(H,7,8) |
| InChIKey | CQCIQXLKPULKPI-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 91.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.19 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|