C28H48N4O3 — CID 135871475
(4S,5S,6R)-1-ethyl-6-methyl-4-(2-phenylethyl)-N-(3-propan-2-yloxypropyl)-2-(3-propan-2-yloxypropylimino)-1,3-diazinane-5-carboxamide (PubChem CID 135871475) has the molecular formula C28H48N4O3 and a molecular weight of 488.72 g/mol. Its IUPAC name is (4S,5S,6R)-1-ethyl-6-methyl-4-(2-phenylethyl)-N-(3-propan-2-yloxypropyl)-2-(3-propan-2-yloxypropylimino)-1,3-diazinane-5-carboxamide.
| Compound Name | (4S,5S,6R)-1-ethyl-6-methyl-4-(2-phenylethyl)-N-(3-propan-2-yloxypropyl)-2-(3-propan-2-yloxypropylimino)-1,3-diazinane-5-carboxamide |
|---|---|
| PubChem CID | 135871475 |
| Molecular Formula | C28H48N4O3 |
| Molecular Weight | 488.72 g/mol |
| Exact Mass | 488.37 |
| IUPAC Name | (4S,5S,6R)-1-ethyl-6-methyl-4-(2-phenylethyl)-N-(3-propan-2-yloxypropyl)-2-(3-propan-2-yloxypropylimino)-1,3-diazinane-5-carboxamide |
| SMILES | CCN1/C(=N\CCCOC(C)C)N[C@@H](CCc2ccccc2)[C@H](C(=O)NCCCOC(C)C)[C@H]1C |
| InChI | InChI=1S/C28H48N4O3/c1-7-32-23(6)26(27(33)29-17-11-19-34-21(2)3)25(16-15-24-13-9-8-10-14-24)31-28(32)30-18-12-20-35-22(4)5/h8-10,13-14,21-23,25-26H,7,11-12,15-20H2,1-6H3,(H,29,33)(H,30,31)/t23-,25+,26-/m1/s1 |
| InChIKey | BQCPIVFXMJXKFT-DMTNHVFBSA-N |
| XLogP | 4.02 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.72 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|