C20H25N3O2S — CID 135872552
4-(4-tert-butyl-1,3-thiazol-2-yl)-5-imino-1-[2-(2-methoxyphenyl)ethyl]-2H-pyrrol-3-ol (PubChem CID 135872552) has the molecular formula C20H25N3O2S and a molecular weight of 371.51 g/mol. Its IUPAC name is 4-(4-tert-butyl-1,3-thiazol-2-yl)-5-imino-1-[2-(2-methoxyphenyl)ethyl]-2H-pyrrol-3-ol.
| Compound Name | 4-(4-tert-butyl-1,3-thiazol-2-yl)-5-imino-1-[2-(2-methoxyphenyl)ethyl]-2H-pyrrol-3-ol |
|---|---|
| PubChem CID | 135872552 |
| Molecular Formula | C20H25N3O2S |
| Molecular Weight | 371.51 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | 4-(4-tert-butyl-1,3-thiazol-2-yl)-5-imino-1-[2-(2-methoxyphenyl)ethyl]-2H-pyrrol-3-ol |
| SMILES | [H]/N=C1/C(c2nc(C(C)(C)C)cs2)=C(O)CN1CCc1ccccc1OC |
| InChI | InChI=1S/C20H25N3O2S/c1-20(2,3)16-12-26-19(22-16)17-14(24)11-23(18(17)21)10-9-13-7-5-6-8-15(13)25-4/h5-8,12,21,24H,9-11H2,1-4H3/b21-18- |
| InChIKey | FCGITTOZKQUAJX-UZYVYHOESA-N |
| XLogP | 4.25 |
| TPSA | 69.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.51 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|