C26H29N2O3S+ — CID 135873517
(Z)-N-(4-ethoxyphenyl)-3-hydroxy-2-[4-(3-hydroxypropyl)pyridin-1-ium-1-yl]-3-(4-methylphenyl)prop-2-enethioamide (PubChem CID 135873517) has the molecular formula C26H29N2O3S+ and a molecular weight of 449.60 g/mol. Its IUPAC name is (Z)-N-(4-ethoxyphenyl)-3-hydroxy-2-[4-(3-hydroxypropyl)pyridin-1-ium-1-yl]-3-(4-methylphenyl)prop-2-enethioamide.
| Compound Name | (Z)-N-(4-ethoxyphenyl)-3-hydroxy-2-[4-(3-hydroxypropyl)pyridin-1-ium-1-yl]-3-(4-methylphenyl)prop-2-enethioamide |
|---|---|
| PubChem CID | 135873517 |
| Molecular Formula | C26H29N2O3S+ |
| Molecular Weight | 449.60 g/mol |
| Exact Mass | 449.19 |
| IUPAC Name | (Z)-N-(4-ethoxyphenyl)-3-hydroxy-2-[4-(3-hydroxypropyl)pyridin-1-ium-1-yl]-3-(4-methylphenyl)prop-2-enethioamide |
| SMILES | CCOc1ccc(NC(=S)/C(=C(/O)c2ccc(C)cc2)[n+]2ccc(CCCO)cc2)cc1 |
| InChI | InChI=1S/C26H28N2O3S/c1-3-31-23-12-10-22(11-13-23)27-26(32)24(25(30)21-8-6-19(2)7-9-21)28-16-14-20(15-17-28)5-4-18-29/h6-17,29H,3-5,18H2,1-2H3,(H-,27,30,32)/p+1 |
| InChIKey | BBFKOYZUMPSHLS-UHFFFAOYSA-O |
| XLogP | 4.93 |
| TPSA | 65.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.60 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|