C20H22N4O3S — CID 135873992
N-[(E)-[7-hydroxy-2-(4-hydroxyphenyl)-2,3-dihydrochromen-4-ylidene]amino]piperazine-1-carbothioamide (PubChem CID 135873992) has the molecular formula C20H22N4O3S and a molecular weight of 398.49 g/mol. Its IUPAC name is N-[(E)-[7-hydroxy-2-(4-hydroxyphenyl)-2,3-dihydrochromen-4-ylidene]amino]piperazine-1-carbothioamide.
| Compound Name | N-[(E)-[7-hydroxy-2-(4-hydroxyphenyl)-2,3-dihydrochromen-4-ylidene]amino]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 135873992 |
| Molecular Formula | C20H22N4O3S |
| Molecular Weight | 398.49 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | N-[(E)-[7-hydroxy-2-(4-hydroxyphenyl)-2,3-dihydrochromen-4-ylidene]amino]piperazine-1-carbothioamide |
| SMILES | Oc1ccc(C2C/C(=N\NC(=S)N3CCNCC3)c3ccc(O)cc3O2)cc1 |
| InChI | InChI=1S/C20H22N4O3S/c25-14-3-1-13(2-4-14)18-12-17(16-6-5-15(26)11-19(16)27-18)22-23-20(28)24-9-7-21-8-10-24/h1-6,11,18,21,25-26H,7-10,12H2,(H,23,28)/b22-17+ |
| InChIKey | GQFVRDJPNSQWDN-OQKWZONESA-N |
| XLogP | 2.11 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.49 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|