C23H18N6O — CID 135874647
(9R,11R)-9-(2-methylphenyl)-11-pyridin-3-yl-8-oxa-12,13,14,15,17-pentazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,13,15-hexaene (PubChem CID 135874647) has the molecular formula C23H18N6O and a molecular weight of 394.44 g/mol. Its IUPAC name is (9R,11R)-9-(2-methylphenyl)-11-pyridin-3-yl-8-oxa-12,13,14,15,17-pentazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,13,15-hexaene.
| Compound Name | (9R,11R)-9-(2-methylphenyl)-11-pyridin-3-yl-8-oxa-12,13,14,15,17-pentazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,13,15-hexaene |
|---|---|
| PubChem CID | 135874647 |
| Molecular Formula | C23H18N6O |
| Molecular Weight | 394.44 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | (9R,11R)-9-(2-methylphenyl)-11-pyridin-3-yl-8-oxa-12,13,14,15,17-pentazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,13,15-hexaene |
| SMILES | Cc1ccccc1[C@H]1Oc2ccccc2C2=C1[C@@H](c1cccnc1)n1nnnc1N2 |
| InChI | InChI=1S/C23H18N6O/c1-14-7-2-3-9-16(14)22-19-20(17-10-4-5-11-18(17)30-22)25-23-26-27-28-29(23)21(19)15-8-6-12-24-13-15/h2-13,21-22H,1H3,(H,25,26,28)/t21-,22-/m1/s1 |
| InChIKey | OCHVKAABMKPPQK-FGZHOGPDSA-N |
| XLogP | 3.94 |
| TPSA | 77.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.44 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |