C19H14N2O2S2 — CID 135880757
4-hydroxy-5-[(Z)-(5-phenylmethoxyindol-3-ylidene)methyl]-3H-1,3-thiazole-2-thione (PubChem CID 135880757) has the molecular formula C19H14N2O2S2 and a molecular weight of 366.47 g/mol. Its IUPAC name is 4-hydroxy-5-[(Z)-(5-phenylmethoxyindol-3-ylidene)methyl]-3H-1,3-thiazole-2-thione.
| Compound Name | 4-hydroxy-5-[(Z)-(5-phenylmethoxyindol-3-ylidene)methyl]-3H-1,3-thiazole-2-thione |
|---|---|
| PubChem CID | 135880757 |
| Molecular Formula | C19H14N2O2S2 |
| Molecular Weight | 366.47 g/mol |
| Exact Mass | 366.05 |
| IUPAC Name | 4-hydroxy-5-[(Z)-(5-phenylmethoxyindol-3-ylidene)methyl]-3H-1,3-thiazole-2-thione |
| SMILES | Oc1[nH]c(=S)sc1/C=C1\C=Nc2ccc(OCc3ccccc3)cc21 |
| InChI | InChI=1S/C19H14N2O2S2/c22-18-17(25-19(24)21-18)8-13-10-20-16-7-6-14(9-15(13)16)23-11-12-4-2-1-3-5-12/h1-10,22H,11H2,(H,21,24)/b13-8+ |
| InChIKey | LKPRFBQNIBBADU-MDWZMJQESA-N |
| XLogP | 5.35 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.47 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|