C25H19ClN6O4 — CID 135881940
benzyl (7S)-7-(4-chloro-3-nitrophenyl)-5-methyl-2-pyridin-3-yl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate (PubChem CID 135881940) has the molecular formula C25H19ClN6O4 and a molecular weight of 502.92 g/mol. Its IUPAC name is benzyl (7S)-7-(4-chloro-3-nitrophenyl)-5-methyl-2-pyridin-3-yl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate.
| Compound Name | benzyl (7S)-7-(4-chloro-3-nitrophenyl)-5-methyl-2-pyridin-3-yl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 135881940 |
| Molecular Formula | C25H19ClN6O4 |
| Molecular Weight | 502.92 g/mol |
| Exact Mass | 502.12 |
| IUPAC Name | benzyl (7S)-7-(4-chloro-3-nitrophenyl)-5-methyl-2-pyridin-3-yl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
| SMILES | CC1=C(C(=O)OCc2ccccc2)[C@H](c2ccc(Cl)c([N+](=O)[O-])c2)n2nc(-c3cccnc3)nc2N1 |
| InChI | InChI=1S/C25H19ClN6O4/c1-15-21(24(33)36-14-16-6-3-2-4-7-16)22(17-9-10-19(26)20(12-17)32(34)35)31-25(28-15)29-23(30-31)18-8-5-11-27-13-18/h2-13,22H,14H2,1H3,(H,28,29,30)/t22-/m0/s1 |
| InChIKey | PRYXOJQAIDZHDE-QFIPXVFZSA-N |
| XLogP | 4.93 |
| TPSA | 125.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.92 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|