About 4-[4-(1H-indol-3-yl)-1,3-oxazol-2-yl]-2-methoxyphenol
4-[4-(1H-indol-3-yl)-1,3-oxazol-2-yl]-2-methoxyphenol (PubChem CID 135883364) has the molecular formula C18H14N2O3
and a molecular weight of 306.32 g/mol. Its IUPAC name is 4-[4-(1H-indol-3-yl)-1,3-oxazol-2-yl]-2-methoxyphenol.
Molecular Properties
| Compound Name | 4-[4-(1H-indol-3-yl)-1,3-oxazol-2-yl]-2-methoxyphenol |
| PubChem CID | 135883364 |
| Molecular Formula | C18H14N2O3 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | 4-[4-(1H-indol-3-yl)-1,3-oxazol-2-yl]-2-methoxyphenol |
| SMILES | COc1cc(-c2nc(-c3c[nH]c4ccccc34)co2)ccc1O |
| InChI | InChI=1S/C18H14N2O3/c1-22-17-8-11(6-7-16(17)21)18-20-15(10-23-18)13-9-19-14-5-3-2-4-12(13)14/h2-10,19,21H,1H3 |
| InChIKey | UPEOZMDZRGORAO-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 71.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[4-(1H-indol-3-yl)-1,3-oxazol-2-yl]-2-methoxyphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(1H-indol-3-yl)-1,3-oxazol-2-yl]-2-methoxyphenol?
The IUPAC name of 4-[4-(1H-indol-3-yl)-1,3-oxazol-2-yl]-2-methoxyphenol (CID 135883364) is 4-[4-(1H-indol-3-yl)-1,3-oxazol-2-yl]-2-methoxyphenol.
What is the SMILES notation for 4-[4-(1H-indol-3-yl)-1,3-oxazol-2-yl]-2-methoxyphenol?
The canonical SMILES for 4-[4-(1H-indol-3-yl)-1,3-oxazol-2-yl]-2-methoxyphenol is COc1cc(-c2nc(-c3c[nH]c4ccccc34)co2)ccc1O.
What is the InChIKey of 4-[4-(1H-indol-3-yl)-1,3-oxazol-2-yl]-2-methoxyphenol?
The InChIKey is UPEOZMDZRGORAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14N2O3/c1-22-17-8-11(6-7-16(17)21)18-20-15(10-23-18)13-9-19-14-5-3-2-4-12(13)14/h2-10,19,21H,1H3.
What are the key properties of 4-[4-(1H-indol-3-yl)-1,3-oxazol-2-yl]-2-methoxyphenol?
4-[4-(1H-indol-3-yl)-1,3-oxazol-2-yl]-2-methoxyphenol has a molecular weight of 306.32 g/mol, XLogP of 4.20, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(1H-indol-3-yl)-1,3-oxazol-2-yl]-2-methoxyphenol is sourced from PubChem (CID 135883364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).