C17H15N3O2 — CID 136822308
2-(1H-indol-3-yl)-5,6-dimethoxy-1H-benzimidazole (PubChem CID 136822308) has the molecular formula C17H15N3O2 and a molecular weight of 293.33 g/mol. Its IUPAC name is 2-(1H-indol-3-yl)-5,6-dimethoxy-1H-benzimidazole.
| Compound Name | 2-(1H-indol-3-yl)-5,6-dimethoxy-1H-benzimidazole |
|---|---|
| PubChem CID | 136822308 |
| Molecular Formula | C17H15N3O2 |
| Molecular Weight | 293.33 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | 2-(1H-indol-3-yl)-5,6-dimethoxy-1H-benzimidazole |
| SMILES | COc1cc2nc(-c3c[nH]c4ccccc34)[nH]c2cc1OC |
| InChI | InChI=1S/C17H15N3O2/c1-21-15-7-13-14(8-16(15)22-2)20-17(19-13)11-9-18-12-6-4-3-5-10(11)12/h3-9,18H,1-2H3,(H,19,20) |
| InChIKey | YDTVTUNFXXLANU-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 62.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.33 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |