C13H11ClN2O3 — CID 106688276
2-(2-chlorofuran-3-yl)-5,6-dimethoxy-1H-benzimidazole (PubChem CID 106688276) has the molecular formula C13H11ClN2O3 and a molecular weight of 278.70 g/mol. Its IUPAC name is 2-(2-chlorofuran-3-yl)-5,6-dimethoxy-1H-benzimidazole.
| Compound Name | 2-(2-chlorofuran-3-yl)-5,6-dimethoxy-1H-benzimidazole |
|---|---|
| PubChem CID | 106688276 |
| Molecular Formula | C13H11ClN2O3 |
| Molecular Weight | 278.70 g/mol |
| Exact Mass | 278.05 |
| IUPAC Name | 2-(2-chlorofuran-3-yl)-5,6-dimethoxy-1H-benzimidazole |
| SMILES | COc1cc2nc(-c3ccoc3Cl)[nH]c2cc1OC |
| InChI | InChI=1S/C13H11ClN2O3/c1-17-10-5-8-9(6-11(10)18-2)16-13(15-8)7-3-4-19-12(7)14/h3-6H,1-2H3,(H,15,16) |
| InChIKey | GBEYVFFMTYSZQG-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 60.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.70 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |