C13H11N5O4 — CID 135883926
(Z)-4-oxo-4-[[N'-(4-oxo-3H-quinazolin-2-yl)carbamimidoyl]amino]but-2-enoic acid (PubChem CID 135883926) has the molecular formula C13H11N5O4 and a molecular weight of 301.26 g/mol. Its IUPAC name is (Z)-4-oxo-4-[[N'-(4-oxo-3H-quinazolin-2-yl)carbamimidoyl]amino]but-2-enoic acid.
| Compound Name | (Z)-4-oxo-4-[[N'-(4-oxo-3H-quinazolin-2-yl)carbamimidoyl]amino]but-2-enoic acid |
|---|---|
| PubChem CID | 135883926 |
| Molecular Formula | C13H11N5O4 |
| Molecular Weight | 301.26 g/mol |
| Exact Mass | 301.08 |
| IUPAC Name | (Z)-4-oxo-4-[[N'-(4-oxo-3H-quinazolin-2-yl)carbamimidoyl]amino]but-2-enoic acid |
| SMILES | NC(=Nc1nc2ccccc2c(=O)[nH]1)NC(=O)/C=C\C(=O)O |
| InChI | InChI=1S/C13H11N5O4/c14-12(16-9(19)5-6-10(20)21)18-13-15-8-4-2-1-3-7(8)11(22)17-13/h1-6H,(H,20,21)(H4,14,15,16,17,18,19,22)/b6-5- |
| InChIKey | AZYNTAJMXQOSNL-WAYWQWQTSA-N |
| XLogP | -0.37 |
| TPSA | 150.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.26 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|