C31H34N4O2 — CID 135886826
(2R)-N-(2,4-dimethylphenyl)-4-methyl-2-(4-pentoxyphenyl)-1,2-dihydropyrimido[1,2-a]benzimidazole-3-carboxamide (PubChem CID 135886826) has the molecular formula C31H34N4O2 and a molecular weight of 494.64 g/mol. Its IUPAC name is (2R)-N-(2,4-dimethylphenyl)-4-methyl-2-(4-pentoxyphenyl)-1,2-dihydropyrimido[1,2-a]benzimidazole-3-carboxamide.
| Compound Name | (2R)-N-(2,4-dimethylphenyl)-4-methyl-2-(4-pentoxyphenyl)-1,2-dihydropyrimido[1,2-a]benzimidazole-3-carboxamide |
|---|---|
| PubChem CID | 135886826 |
| Molecular Formula | C31H34N4O2 |
| Molecular Weight | 494.64 g/mol |
| Exact Mass | 494.27 |
| IUPAC Name | (2R)-N-(2,4-dimethylphenyl)-4-methyl-2-(4-pentoxyphenyl)-1,2-dihydropyrimido[1,2-a]benzimidazole-3-carboxamide |
| SMILES | CCCCCOc1ccc([C@H]2Nc3nc4ccccc4n3C(C)=C2C(=O)Nc2ccc(C)cc2C)cc1 |
| InChI | InChI=1S/C31H34N4O2/c1-5-6-9-18-37-24-15-13-23(14-16-24)29-28(30(36)32-25-17-12-20(2)19-21(25)3)22(4)35-27-11-8-7-10-26(27)33-31(35)34-29/h7-8,10-17,19,29H,5-6,9,18H2,1-4H3,(H,32,36)(H,33,34)/t29-/m1/s1 |
| InChIKey | FITXXABFNBMRPY-GDLZYMKVSA-N |
| XLogP | 7.26 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.64 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|