C16H12FN3OS — CID 135887156
10-[(2-fluorophenyl)methyl]-4-methyl-3-thia-7,10,11-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,11-tetraen-9-one (PubChem CID 135887156) has the molecular formula C16H12FN3OS and a molecular weight of 313.36 g/mol. Its IUPAC name is 10-[(2-fluorophenyl)methyl]-4-methyl-3-thia-7,10,11-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,11-tetraen-9-one.
| Compound Name | 10-[(2-fluorophenyl)methyl]-4-methyl-3-thia-7,10,11-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,11-tetraen-9-one |
|---|---|
| PubChem CID | 135887156 |
| Molecular Formula | C16H12FN3OS |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | 10-[(2-fluorophenyl)methyl]-4-methyl-3-thia-7,10,11-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,11-tetraen-9-one |
| SMILES | Cc1cc2[nH]c3c(=O)n(Cc4ccccc4F)ncc3c2s1 |
| InChI | InChI=1S/C16H12FN3OS/c1-9-6-13-15(22-9)11-7-18-20(16(21)14(11)19-13)8-10-4-2-3-5-12(10)17/h2-7,19H,8H2,1H3 |
| InChIKey | HHJUAYDYHNIVCY-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |