C39H13F15N4O2 — CID 135889780
(E)-[(17E)-17-(hydroxymethylidene)-5,10,15-tris(2,3,4,5,6-pentafluorophenyl)-8,23-dihydro-7H-corrin-3-ylidene]methanol (PubChem CID 135889780) has the molecular formula C39H13F15N4O2 and a molecular weight of 854.53 g/mol. Its IUPAC name is (E)-[(17E)-17-(hydroxymethylidene)-5,10,15-tris(2,3,4,5,6-pentafluorophenyl)-8,23-dihydro-7H-corrin-3-ylidene]methanol.
| Compound Name | (E)-[(17E)-17-(hydroxymethylidene)-5,10,15-tris(2,3,4,5,6-pentafluorophenyl)-8,23-dihydro-7H-corrin-3-ylidene]methanol |
|---|---|
| PubChem CID | 135889780 |
| Molecular Formula | C39H13F15N4O2 |
| Molecular Weight | 854.53 g/mol |
| Exact Mass | 854.08 |
| IUPAC Name | (E)-[(17E)-17-(hydroxymethylidene)-5,10,15-tris(2,3,4,5,6-pentafluorophenyl)-8,23-dihydro-7H-corrin-3-ylidene]methanol |
| SMILES | O/C=C1\C=C2N=C1/C(c1c(F)c(F)c(F)c(F)c1F)=C1/CCC(=N1)/C(c1c(F)c(F)c(F)c(F)c1F)=c1/cc/c([nH]1)=C(\c1c(F)c(F)c(F)c(F)c1F)C1=NC2=C/C1=C\O |
| InChI | InChI=1S/C39H13F15N4O2/c40-23-20(24(41)30(47)35(52)29(23)46)17-11-1-3-13(55-11)18(21-25(42)31(48)36(53)32(49)26(21)43)38-9(7-59)5-15(57-38)16-6-10(8-60)39(58-16)19(14-4-2-12(17)56-14)22-27(44)33(50)37(54)34(51)28(22)45/h1,3,5-8,55,59-60H,2,4H2/b9-7+,10-8+,17-11+,18-13-,19-14- |
| InChIKey | CRWNJHNBWXBBAR-DIUQAWHOSA-N |
| XLogP | 8.72 |
| TPSA | 93.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 854.53 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|