C45H30N4O — CID 135693179
(Z)-(5,10,15,20-tetraphenyl-24H-porphyrin-2-ylidene)methanol (PubChem CID 135693179) has the molecular formula C45H30N4O and a molecular weight of 642.76 g/mol. Its IUPAC name is (Z)-(5,10,15,20-tetraphenyl-24H-porphyrin-2-ylidene)methanol.
| Compound Name | (Z)-(5,10,15,20-tetraphenyl-24H-porphyrin-2-ylidene)methanol |
|---|---|
| PubChem CID | 135693179 |
| Molecular Formula | C45H30N4O |
| Molecular Weight | 642.76 g/mol |
| Exact Mass | 642.24 |
| IUPAC Name | (Z)-(5,10,15,20-tetraphenyl-24H-porphyrin-2-ylidene)methanol |
| SMILES | O/C=C1/C=C2N=C1/C(c1ccccc1)=c1/cc/c([nH]1)=C(\c1ccccc1)C1=N/C(=C(/c3ccccc3)C3=N/C(=C\2c2ccccc2)C=C3)C=C1 |
| InChI | InChI=1S/C45H30N4O/c50-28-33-27-40-43(31-17-9-3-10-18-31)38-24-23-36(47-38)41(29-13-5-1-6-14-29)34-21-22-35(46-34)42(30-15-7-2-8-16-30)37-25-26-39(48-37)44(45(33)49-40)32-19-11-4-12-20-32/h1-28,48,50H/b33-28-,41-34-,42-37-,43-38-,44-39- |
| InChIKey | YFNMKGBSIJIQIY-DGIHBACPSA-N |
| XLogP | 8.05 |
| TPSA | 73.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.76 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|