C12H9N5O2 — CID 135890218
N-[(5R)-6-oxo-1,5-dihydropurin-2-yl]benzamide (PubChem CID 135890218) has the molecular formula C12H9N5O2 and a molecular weight of 255.24 g/mol. Its IUPAC name is N-[(5R)-6-oxo-1,5-dihydropurin-2-yl]benzamide.
| Compound Name | N-[(5R)-6-oxo-1,5-dihydropurin-2-yl]benzamide |
|---|---|
| PubChem CID | 135890218 |
| Molecular Formula | C12H9N5O2 |
| Molecular Weight | 255.24 g/mol |
| Exact Mass | 255.08 |
| IUPAC Name | N-[(5R)-6-oxo-1,5-dihydropurin-2-yl]benzamide |
| SMILES | O=C(NC1=NC2=NC=N[C@H]2C(=O)N1)c1ccccc1 |
| InChI | InChI=1S/C12H9N5O2/c18-10(7-4-2-1-3-5-7)16-12-15-9-8(11(19)17-12)13-6-14-9/h1-6,8H,(H2,13,14,15,16,17,18,19)/t8-/m1/s1 |
| InChIKey | KVSXSVLUBYBPPJ-MRVPVSSYSA-N |
| XLogP | -0.29 |
| TPSA | 95.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.24 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |