C17H13ClN4O4 — CID 135893643
4-chloro-N-methyl-2-nitro-N-[(4-oxo-3H-quinazolin-2-yl)methyl]benzamide (PubChem CID 135893643) has the molecular formula C17H13ClN4O4 and a molecular weight of 372.77 g/mol. Its IUPAC name is 4-chloro-N-methyl-2-nitro-N-[(4-oxo-3H-quinazolin-2-yl)methyl]benzamide.
| Compound Name | 4-chloro-N-methyl-2-nitro-N-[(4-oxo-3H-quinazolin-2-yl)methyl]benzamide |
|---|---|
| PubChem CID | 135893643 |
| Molecular Formula | C17H13ClN4O4 |
| Molecular Weight | 372.77 g/mol |
| Exact Mass | 372.06 |
| IUPAC Name | 4-chloro-N-methyl-2-nitro-N-[(4-oxo-3H-quinazolin-2-yl)methyl]benzamide |
| SMILES | CN(Cc1nc2ccccc2c(=O)[nH]1)C(=O)c1ccc(Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H13ClN4O4/c1-21(17(24)12-7-6-10(18)8-14(12)22(25)26)9-15-19-13-5-3-2-4-11(13)16(23)20-15/h2-8H,9H2,1H3,(H,19,20,23) |
| InChIKey | ZSXZOOQHTYPIID-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 109.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.77 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|