C18H18N4O4S — CID 135971119
N,2-dimethyl-N-[(4-oxo-3H-quinazolin-2-yl)methyl]-5-sulfamoylbenzamide (PubChem CID 135971119) has the molecular formula C18H18N4O4S and a molecular weight of 386.43 g/mol. Its IUPAC name is N,2-dimethyl-N-[(4-oxo-3H-quinazolin-2-yl)methyl]-5-sulfamoylbenzamide.
| Compound Name | N,2-dimethyl-N-[(4-oxo-3H-quinazolin-2-yl)methyl]-5-sulfamoylbenzamide |
|---|---|
| PubChem CID | 135971119 |
| Molecular Formula | C18H18N4O4S |
| Molecular Weight | 386.43 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | N,2-dimethyl-N-[(4-oxo-3H-quinazolin-2-yl)methyl]-5-sulfamoylbenzamide |
| SMILES | Cc1ccc(S(N)(=O)=O)cc1C(=O)N(C)Cc1nc2ccccc2c(=O)[nH]1 |
| InChI | InChI=1S/C18H18N4O4S/c1-11-7-8-12(27(19,25)26)9-14(11)18(24)22(2)10-16-20-15-6-4-3-5-13(15)17(23)21-16/h3-9H,10H2,1-2H3,(H2,19,25,26)(H,20,21,23) |
| InChIKey | NBBUFUHZTMKTBL-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 126.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.43 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |