C16H9ClFN3O2S — CID 135895055
2-[(2-chloro-6-fluorophenyl)methylsulfanyl]-4-(furan-2-yl)-6-oxo-1H-pyrimidine-5-carbonitrile (PubChem CID 135895055) has the molecular formula C16H9ClFN3O2S and a molecular weight of 361.79 g/mol. Its IUPAC name is 2-[(2-chloro-6-fluorophenyl)methylsulfanyl]-4-(furan-2-yl)-6-oxo-1H-pyrimidine-5-carbonitrile.
| Compound Name | 2-[(2-chloro-6-fluorophenyl)methylsulfanyl]-4-(furan-2-yl)-6-oxo-1H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 135895055 |
| Molecular Formula | C16H9ClFN3O2S |
| Molecular Weight | 361.79 g/mol |
| Exact Mass | 361.01 |
| IUPAC Name | 2-[(2-chloro-6-fluorophenyl)methylsulfanyl]-4-(furan-2-yl)-6-oxo-1H-pyrimidine-5-carbonitrile |
| SMILES | N#Cc1c(-c2ccco2)nc(SCc2c(F)cccc2Cl)[nH]c1=O |
| InChI | InChI=1S/C16H9ClFN3O2S/c17-11-3-1-4-12(18)10(11)8-24-16-20-14(13-5-2-6-23-13)9(7-19)15(22)21-16/h1-6H,8H2,(H,20,21,22) |
| InChIKey | XGUCPAMWZPEGPO-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 82.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.79 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'} |
|---|