C23H27N5O5 — CID 135895065
ethyl 1-[(5S)-5-(benzylcarbamoyl)-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidin-2-yl]piperidine-4-carboxylate (PubChem CID 135895065) has the molecular formula C23H27N5O5 and a molecular weight of 453.50 g/mol. Its IUPAC name is ethyl 1-[(5S)-5-(benzylcarbamoyl)-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidin-2-yl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[(5S)-5-(benzylcarbamoyl)-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidin-2-yl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 135895065 |
| Molecular Formula | C23H27N5O5 |
| Molecular Weight | 453.50 g/mol |
| Exact Mass | 453.20 |
| IUPAC Name | ethyl 1-[(5S)-5-(benzylcarbamoyl)-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidin-2-yl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(c2nc3c(c(=O)[nH]2)[C@@H](C(=O)NCc2ccccc2)CC(=O)N3)CC1 |
| InChI | InChI=1S/C23H27N5O5/c1-2-33-22(32)15-8-10-28(11-9-15)23-26-19-18(21(31)27-23)16(12-17(29)25-19)20(30)24-13-14-6-4-3-5-7-14/h3-7,15-16H,2,8-13H2,1H3,(H,24,30)(H2,25,26,27,29,31)/t16-/m0/s1 |
| InChIKey | DZNAJSYFNQBCKD-INIZCTEOSA-N |
| XLogP | 1.29 |
| TPSA | 133.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.50 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |