C18H25N5O5 — CID 135895070
ethyl 1-[(5R)-5-(ethylcarbamoyl)-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidin-2-yl]piperidine-4-carboxylate (PubChem CID 135895070) has the molecular formula C18H25N5O5 and a molecular weight of 391.43 g/mol. Its IUPAC name is ethyl 1-[(5R)-5-(ethylcarbamoyl)-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidin-2-yl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[(5R)-5-(ethylcarbamoyl)-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidin-2-yl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 135895070 |
| Molecular Formula | C18H25N5O5 |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | ethyl 1-[(5R)-5-(ethylcarbamoyl)-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidin-2-yl]piperidine-4-carboxylate |
| SMILES | CCNC(=O)[C@@H]1CC(=O)Nc2nc(N3CCC(C(=O)OCC)CC3)[nH]c(=O)c21 |
| InChI | InChI=1S/C18H25N5O5/c1-3-19-15(25)11-9-12(24)20-14-13(11)16(26)22-18(21-14)23-7-5-10(6-8-23)17(27)28-4-2/h10-11H,3-9H2,1-2H3,(H,19,25)(H2,20,21,22,24,26)/t11-/m1/s1 |
| InChIKey | SNEMOLSEIKUAJX-LLVKDONJSA-N |
| XLogP | 0.11 |
| TPSA | 133.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |