C16H19N3O4 — CID 135895720
6-hydroxy-5-[[(2R)-1-hydroxy-3-phenylpropan-2-yl]iminomethyl]-1,3-dimethylpyrimidine-2,4-dione (PubChem CID 135895720) has the molecular formula C16H19N3O4 and a molecular weight of 317.35 g/mol. Its IUPAC name is 6-hydroxy-5-[[(2R)-1-hydroxy-3-phenylpropan-2-yl]iminomethyl]-1,3-dimethylpyrimidine-2,4-dione.
| Compound Name | 6-hydroxy-5-[[(2R)-1-hydroxy-3-phenylpropan-2-yl]iminomethyl]-1,3-dimethylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 135895720 |
| Molecular Formula | C16H19N3O4 |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | 6-hydroxy-5-[[(2R)-1-hydroxy-3-phenylpropan-2-yl]iminomethyl]-1,3-dimethylpyrimidine-2,4-dione |
| SMILES | Cn1c(O)c(/C=N/[C@@H](CO)Cc2ccccc2)c(=O)n(C)c1=O |
| InChI | InChI=1S/C16H19N3O4/c1-18-14(21)13(15(22)19(2)16(18)23)9-17-12(10-20)8-11-6-4-3-5-7-11/h3-7,9,12,20-21H,8,10H2,1-2H3/b17-9+/t12-/m1/s1 |
| InChIKey | PQCARMLJLQNECZ-UDPFGDFPSA-N |
| XLogP | -0.19 |
| TPSA | 96.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|