C17H16F2N4O — CID 135898981
2-[4-[[(2R)-2-aminopropyl]amino]quinazolin-2-yl]-3,4-difluorophenol (PubChem CID 135898981) has the molecular formula C17H16F2N4O and a molecular weight of 330.34 g/mol. Its IUPAC name is 2-[4-[[(2R)-2-aminopropyl]amino]quinazolin-2-yl]-3,4-difluorophenol.
| Compound Name | 2-[4-[[(2R)-2-aminopropyl]amino]quinazolin-2-yl]-3,4-difluorophenol |
|---|---|
| PubChem CID | 135898981 |
| Molecular Formula | C17H16F2N4O |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | 2-[4-[[(2R)-2-aminopropyl]amino]quinazolin-2-yl]-3,4-difluorophenol |
| SMILES | C[C@@H](N)CNc1nc(-c2c(O)ccc(F)c2F)nc2ccccc12 |
| InChI | InChI=1S/C17H16F2N4O/c1-9(20)8-21-16-10-4-2-3-5-12(10)22-17(23-16)14-13(24)7-6-11(18)15(14)19/h2-7,9,24H,8,20H2,1H3,(H,21,22,23)/t9-/m1/s1 |
| InChIKey | WAABZXPRANIAOK-SECBINFHSA-N |
| XLogP | 3.04 |
| TPSA | 84.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |